C9H17N — CID 123802407
N,2-dimethylcyclopenta-1,4-dien-1-amine;ethane (PubChem CID 123802407) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is N,2-dimethylcyclopenta-1,4-dien-1-amine;ethane.
| Compound Name | N,2-dimethylcyclopenta-1,4-dien-1-amine;ethane |
|---|---|
| PubChem CID | 123802407 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | N,2-dimethylcyclopenta-1,4-dien-1-amine;ethane |
| SMILES | CC.CNC1=C(C)CC=C1 |
| InChI | InChI=1S/C7H11N.C2H6/c1-6-4-3-5-7(6)8-2;1-2/h3,5,8H,4H2,1-2H3;1-2H3 |
| InChIKey | JCDZWZGVZJQUEQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |