C10H17N — CID 174436418
azetidine;1,2-dimethylcyclopenta-1,3-diene (PubChem CID 174436418) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is azetidine;1,2-dimethylcyclopenta-1,3-diene.
| Compound Name | azetidine;1,2-dimethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 174436418 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | azetidine;1,2-dimethylcyclopenta-1,3-diene |
| SMILES | C1CNC1.CC1=C(C)CC=C1 |
| InChI | InChI=1S/C7H10.C3H7N/c1-6-4-3-5-7(6)2;1-2-4-3-1/h3-4H,5H2,1-2H3;4H,1-3H2 |
| InChIKey | CSAUGMFPWIBGGU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |