C7H11Na — CID 173341560
sodium;1,2-dimethylcyclopenta-1,3-diene;hydride (PubChem CID 173341560) has the molecular formula C7H11Na and a molecular weight of 118.15 g/mol. Its IUPAC name is sodium;1,2-dimethylcyclopenta-1,3-diene;hydride.
| Compound Name | sodium;1,2-dimethylcyclopenta-1,3-diene;hydride |
|---|---|
| PubChem CID | 173341560 |
| Molecular Formula | C7H11Na |
| Molecular Weight | 118.15 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | sodium;1,2-dimethylcyclopenta-1,3-diene;hydride |
| SMILES | CC1=C(C)CC=C1.[H-].[Na+] |
| InChI | InChI=1S/C7H10.Na.H/c1-6-4-3-5-7(6)2;;/h3-4H,5H2,1-2H3;;/q;+1;-1 |
| InChIKey | YZQIBBKDXGPIAW-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.15 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |