C39H18F10 — CID 122388116
10,20-bis(2,3,4,5,6-pentafluorophenyl)hexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,13(17),14,20,22,24,26-dodecaene (PubChem CID 122388116) has the molecular formula C39H18F10 and a molecular weight of 676.55 g/mol. Its IUPAC name is 10,20-bis(2,3,4,5,6-pentafluorophenyl)hexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,13(17),14,20,22,24,26-dodecaene.
| Compound Name | 10,20-bis(2,3,4,5,6-pentafluorophenyl)hexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,13(17),14,20,22,24,26-dodecaene |
|---|---|
| PubChem CID | 122388116 |
| Molecular Formula | C39H18F10 |
| Molecular Weight | 676.55 g/mol |
| Exact Mass | 676.12 |
| IUPAC Name | 10,20-bis(2,3,4,5,6-pentafluorophenyl)hexacyclo[17.8.0.02,11.03,8.013,17.022,27]heptacosa-1(19),2(11),3,5,7,9,13(17),14,20,22,24,26-dodecaene |
| SMILES | Fc1c(F)c(F)c(-c2cc3ccccc3c3c2CC2=C(CC=C2)Cc2c(-c4c(F)c(F)c(F)c(F)c4F)cc4ccccc4c2-3)c(F)c1F |
| InChI | InChI=1S/C39H18F10/c40-30-28(31(41)35(45)38(48)34(30)44)24-14-18-6-1-3-10-20(18)26-22(24)12-16-8-5-9-17(16)13-23-25(15-19-7-2-4-11-21(19)27(23)26)29-32(42)36(46)39(49)37(47)33(29)43/h1-8,10-11,14-15H,9,12-13H2 |
| InChIKey | ZKXICPPIKUZZCT-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.55 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|