C45H24F5N3 — CID 156695703
2-(4-naphthalen-1-ylphenyl)-4-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-6-phenanthren-9-yl-1,3,5-triazine (PubChem CID 156695703) has the molecular formula C45H24F5N3 and a molecular weight of 701.70 g/mol. Its IUPAC name is 2-(4-naphthalen-1-ylphenyl)-4-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-6-phenanthren-9-yl-1,3,5-triazine.
| Compound Name | 2-(4-naphthalen-1-ylphenyl)-4-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-6-phenanthren-9-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 156695703 |
| Molecular Formula | C45H24F5N3 |
| Molecular Weight | 701.70 g/mol |
| Exact Mass | 701.19 |
| IUPAC Name | 2-(4-naphthalen-1-ylphenyl)-4-[4-(2,3,4,5,6-pentafluorophenyl)phenyl]-6-phenanthren-9-yl-1,3,5-triazine |
| SMILES | Fc1c(F)c(F)c(-c2ccc(-c3nc(-c4ccc(-c5cccc6ccccc56)cc4)nc(-c4cc5ccccc5c5ccccc45)n3)cc2)c(F)c1F |
| InChI | InChI=1S/C45H24F5N3/c46-38-37(39(47)41(49)42(50)40(38)48)27-18-22-29(23-19-27)44-51-43(28-20-16-26(17-21-28)32-15-7-10-25-8-1-3-11-31(25)32)52-45(53-44)36-24-30-9-2-4-12-33(30)34-13-5-6-14-35(34)36/h1-24H |
| InChIKey | PGYOOJXNFMPAMD-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.70 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|