C41H25F2N3 — CID 159255421
2,4-bis(4-fluorophenyl)-6-[4-(4-phenanthren-9-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 159255421) has the molecular formula C41H25F2N3 and a molecular weight of 597.67 g/mol. Its IUPAC name is 2,4-bis(4-fluorophenyl)-6-[4-(4-phenanthren-9-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(4-fluorophenyl)-6-[4-(4-phenanthren-9-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 159255421 |
| Molecular Formula | C41H25F2N3 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 2,4-bis(4-fluorophenyl)-6-[4-(4-phenanthren-9-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(-c3ccc(F)cc3)nc(-c3ccc(-c4ccc(-c5cc6ccccc6c6ccccc56)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C41H25F2N3/c42-33-21-17-30(18-22-33)40-44-39(45-41(46-40)31-19-23-34(43)24-20-31)29-15-11-27(12-16-29)26-9-13-28(14-10-26)38-25-32-5-1-2-6-35(32)36-7-3-4-8-37(36)38/h1-25H |
| InChIKey | KXTDBSHBPKXEJQ-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|