C41H17F10N3 — CID 174244258
2-[6-(3-naphthalen-1-ylphenyl)naphthalen-2-yl]-4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine (PubChem CID 174244258) has the molecular formula C41H17F10N3 and a molecular weight of 741.59 g/mol. Its IUPAC name is 2-[6-(3-naphthalen-1-ylphenyl)naphthalen-2-yl]-4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine.
| Compound Name | 2-[6-(3-naphthalen-1-ylphenyl)naphthalen-2-yl]-4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 174244258 |
| Molecular Formula | C41H17F10N3 |
| Molecular Weight | 741.59 g/mol |
| Exact Mass | 741.13 |
| IUPAC Name | 2-[6-(3-naphthalen-1-ylphenyl)naphthalen-2-yl]-4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazine |
| SMILES | Fc1c(F)c(F)c(-c2nc(-c3ccc4cc(-c5cccc(-c6cccc7ccccc67)c5)ccc4c3)nc(-c3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C41H17F10N3/c42-29-27(30(43)34(47)37(50)33(29)46)40-52-39(53-41(54-40)28-31(44)35(48)38(51)36(49)32(28)45)24-14-13-21-15-20(11-12-22(21)17-24)19-7-3-8-23(16-19)26-10-4-6-18-5-1-2-9-25(18)26/h1-17H |
| InChIKey | VDDQEHWPPMXJSR-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.59 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|