C13H14O — CID 141319272
2,5,6,7,8,9-hexahydrofluoren-1-one (PubChem CID 141319272) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is 2,5,6,7,8,9-hexahydrofluoren-1-one.
| Compound Name | 2,5,6,7,8,9-hexahydrofluoren-1-one |
|---|---|
| PubChem CID | 141319272 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2,5,6,7,8,9-hexahydrofluoren-1-one |
| SMILES | O=C1CC=CC2=C1CC1=C2CCCC1 |
| InChI | InChI=1S/C13H14O/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13/h3,6H,1-2,4-5,7-8H2 |
| InChIKey | LCGGTLFNCGMJHN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |