C15H24O — CID 11031398
1,2,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclopenta[12]annulen-3-one (PubChem CID 11031398) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 1,2,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclopenta[12]annulen-3-one.
| Compound Name | 1,2,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclopenta[12]annulen-3-one |
|---|---|
| PubChem CID | 11031398 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1,2,4,5,6,7,8,9,10,11,12,13-dodecahydrocyclopenta[12]annulen-3-one |
| SMILES | O=C1CCC2=C1CCCCCCCCCC2 |
| InChI | InChI=1S/C15H24O/c16-15-12-11-13-9-7-5-3-1-2-4-6-8-10-14(13)15/h1-12H2 |
| InChIKey | XJLVRZOPNZLSSM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |