C15H24O — CID 59550294
2-methyl-2,3,5,6,7,8,9,10,11,12-decahydro-1H-benzo[10]annulen-4-one (PubChem CID 59550294) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-methyl-2,3,5,6,7,8,9,10,11,12-decahydro-1H-benzo[10]annulen-4-one.
| Compound Name | 2-methyl-2,3,5,6,7,8,9,10,11,12-decahydro-1H-benzo[10]annulen-4-one |
|---|---|
| PubChem CID | 59550294 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-methyl-2,3,5,6,7,8,9,10,11,12-decahydro-1H-benzo[10]annulen-4-one |
| SMILES | CC1CC(=O)C2=C(CCCCCCCC2)C1 |
| InChI | InChI=1S/C15H24O/c1-12-10-13-8-6-4-2-3-5-7-9-14(13)15(16)11-12/h12H,2-11H2,1H3 |
| InChIKey | AIDCEGQHTVUCEQ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |