C10H12O2 — CID 22709046
3,4,5,6,7,8-hexahydronaphthalene-1,2-dione (PubChem CID 22709046) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexahydronaphthalene-1,2-dione.
| Compound Name | 3,4,5,6,7,8-hexahydronaphthalene-1,2-dione |
|---|---|
| PubChem CID | 22709046 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 3,4,5,6,7,8-hexahydronaphthalene-1,2-dione |
| SMILES | O=C1CCC2=C(CCCC2)C1=O |
| InChI | InChI=1S/C10H12O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H2 |
| InChIKey | XXWJZHDUAJDDAF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|