C15H18 — CID 102207082
(2-tert-butylcyclopenta-1,4-dien-1-yl)benzene (PubChem CID 102207082) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2-tert-butylcyclopenta-1,4-dien-1-yl)benzene.
| Compound Name | (2-tert-butylcyclopenta-1,4-dien-1-yl)benzene |
|---|---|
| PubChem CID | 102207082 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (2-tert-butylcyclopenta-1,4-dien-1-yl)benzene |
| SMILES | CC(C)(C)C1=C(c2ccccc2)C=CC1 |
| InChI | InChI=1S/C15H18/c1-15(2,3)14-11-7-10-13(14)12-8-5-4-6-9-12/h4-10H,11H2,1-3H3 |
| InChIKey | FSQFVCSSHODXOD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |