C11H10ClP — CID 137227869
chloro-(2-phenylcyclopenta-1,3-dien-1-yl)phosphane (PubChem CID 137227869) has the molecular formula C11H10ClP and a molecular weight of 208.63 g/mol. Its IUPAC name is chloro-(2-phenylcyclopenta-1,3-dien-1-yl)phosphane.
| Compound Name | chloro-(2-phenylcyclopenta-1,3-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 137227869 |
| Molecular Formula | C11H10ClP |
| Molecular Weight | 208.63 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | chloro-(2-phenylcyclopenta-1,3-dien-1-yl)phosphane |
| SMILES | ClPC1=C(c2ccccc2)C=CC1 |
| InChI | InChI=1S/C11H10ClP/c12-13-11-8-4-7-10(11)9-5-2-1-3-6-9/h1-7,13H,8H2 |
| InChIKey | GQNDVRFHUSFGIH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.63 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|