C16H24N2 — CID 164983625
5-tert-butyl-1,3-dimethyl-6-phenyl-2,4-dihydropyrimidine (PubChem CID 164983625) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 5-tert-butyl-1,3-dimethyl-6-phenyl-2,4-dihydropyrimidine.
| Compound Name | 5-tert-butyl-1,3-dimethyl-6-phenyl-2,4-dihydropyrimidine |
|---|---|
| PubChem CID | 164983625 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 5-tert-butyl-1,3-dimethyl-6-phenyl-2,4-dihydropyrimidine |
| SMILES | CN1CC(C(C)(C)C)=C(c2ccccc2)N(C)C1 |
| InChI | InChI=1S/C16H24N2/c1-16(2,3)14-11-17(4)12-18(5)15(14)13-9-7-6-8-10-13/h6-10H,11-12H2,1-5H3 |
| InChIKey | MLLUHDHQZNWVIC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |