C15H29N — CID 23402540
5,6-ditert-butyl-1-methyl-2,3,4,7-tetrahydroazepine (PubChem CID 23402540) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 5,6-ditert-butyl-1-methyl-2,3,4,7-tetrahydroazepine.
| Compound Name | 5,6-ditert-butyl-1-methyl-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 23402540 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 5,6-ditert-butyl-1-methyl-2,3,4,7-tetrahydroazepine |
| SMILES | CN1CCCC(C(C)(C)C)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C15H29N/c1-14(2,3)12-9-8-10-16(7)11-13(12)15(4,5)6/h8-11H2,1-7H3 |
| InChIKey | MDKRLEBQJLGWTF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|