C17H22 — CID 142867812
1-tert-butyl-5-methyl-2-phenylcyclohexa-1,3-diene (PubChem CID 142867812) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-tert-butyl-5-methyl-2-phenylcyclohexa-1,3-diene.
| Compound Name | 1-tert-butyl-5-methyl-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142867812 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-tert-butyl-5-methyl-2-phenylcyclohexa-1,3-diene |
| SMILES | CC1C=CC(c2ccccc2)=C(C(C)(C)C)C1 |
| InChI | InChI=1S/C17H22/c1-13-10-11-15(14-8-6-5-7-9-14)16(12-13)17(2,3)4/h5-11,13H,12H2,1-4H3 |
| InChIKey | HJXCWPVGYHYPDP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |