C19H18 — CID 154531936
5-methyl-1,3-diphenylcyclohexa-1,3-diene (PubChem CID 154531936) has the molecular formula C19H18 and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-methyl-1,3-diphenylcyclohexa-1,3-diene.
| Compound Name | 5-methyl-1,3-diphenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 154531936 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-methyl-1,3-diphenylcyclohexa-1,3-diene |
| SMILES | CC1C=C(c2ccccc2)C=C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H18/c1-15-12-18(16-8-4-2-5-9-16)14-19(13-15)17-10-6-3-7-11-17/h2-12,14-15H,13H2,1H3 |
| InChIKey | UYIRGRQMTMNGEV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |