About 5-methyl-1,3-diphenylcyclohexa-1,3-diene
5-methyl-1,3-diphenylcyclohexa-1,3-diene (PubChem CID 154531936) has the molecular formula C19H18
and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-methyl-1,3-diphenylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-methyl-1,3-diphenylcyclohexa-1,3-diene |
| PubChem CID | 154531936 |
| Molecular Formula | C19H18 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 5-methyl-1,3-diphenylcyclohexa-1,3-diene |
| SMILES | CC1C=C(c2ccccc2)C=C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H18/c1-15-12-18(16-8-4-2-5-9-16)14-19(13-15)17-10-6-3-7-11-17/h2-12,14-15H,13H2,1H3 |
| InChIKey | UYIRGRQMTMNGEV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-methyl-1,3-diphenylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,3-diphenylcyclohexa-1,3-diene?
The IUPAC name of 5-methyl-1,3-diphenylcyclohexa-1,3-diene (CID 154531936) is 5-methyl-1,3-diphenylcyclohexa-1,3-diene.
What is the SMILES notation for 5-methyl-1,3-diphenylcyclohexa-1,3-diene?
The canonical SMILES for 5-methyl-1,3-diphenylcyclohexa-1,3-diene is CC1C=C(c2ccccc2)C=C(c2ccccc2)C1.
What is the InChIKey of 5-methyl-1,3-diphenylcyclohexa-1,3-diene?
The InChIKey is UYIRGRQMTMNGEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18/c1-15-12-18(16-8-4-2-5-9-16)14-19(13-15)17-10-6-3-7-11-17/h2-12,14-15H,13H2,1H3.
What are the key properties of 5-methyl-1,3-diphenylcyclohexa-1,3-diene?
5-methyl-1,3-diphenylcyclohexa-1,3-diene has a molecular weight of 246.35 g/mol, XLogP of 5.19, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,3-diphenylcyclohexa-1,3-diene is sourced from PubChem (CID 154531936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).