C20H18 — CID 145073335
7-methyl-2,4-diphenylbicyclo[4.1.0]hepta-2,4-diene (PubChem CID 145073335) has the molecular formula C20H18 and a molecular weight of 258.36 g/mol. Its IUPAC name is 7-methyl-2,4-diphenylbicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 7-methyl-2,4-diphenylbicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 145073335 |
| Molecular Formula | C20H18 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 7-methyl-2,4-diphenylbicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC1C2C=C(c3ccccc3)C=C(c3ccccc3)C12 |
| InChI | InChI=1S/C20H18/c1-14-18-12-17(15-8-4-2-5-9-15)13-19(20(14)18)16-10-6-3-7-11-16/h2-14,18,20H,1H3 |
| InChIKey | XLKQCABUPPWDBJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |