C45H39N3 — CID 121356848
(2S)-1-(2-aminophenyl)-N-[4-[(3S)-3-methyl-5-phenylcyclohexa-1,5-dien-1-yl]-2-(4-phenylphenyl)phenyl]-3-phenylaziridin-2-amine (PubChem CID 121356848) has the molecular formula C45H39N3 and a molecular weight of 621.83 g/mol. Its IUPAC name is (2S)-1-(2-aminophenyl)-N-[4-[(3S)-3-methyl-5-phenylcyclohexa-1,5-dien-1-yl]-2-(4-phenylphenyl)phenyl]-3-phenylaziridin-2-amine.
| Compound Name | (2S)-1-(2-aminophenyl)-N-[4-[(3S)-3-methyl-5-phenylcyclohexa-1,5-dien-1-yl]-2-(4-phenylphenyl)phenyl]-3-phenylaziridin-2-amine |
|---|---|
| PubChem CID | 121356848 |
| Molecular Formula | C45H39N3 |
| Molecular Weight | 621.83 g/mol |
| Exact Mass | 621.31 |
| IUPAC Name | (2S)-1-(2-aminophenyl)-N-[4-[(3S)-3-methyl-5-phenylcyclohexa-1,5-dien-1-yl]-2-(4-phenylphenyl)phenyl]-3-phenylaziridin-2-amine |
| SMILES | C[C@@H]1C=C(c2ccc(N[C@@H]3C(c4ccccc4)N3c3ccccc3N)c(-c3ccc(-c4ccccc4)cc3)c2)C=C(c2ccccc2)C1 |
| InChI | InChI=1S/C45H39N3/c1-31-27-38(33-15-7-3-8-16-33)29-39(28-31)37-25-26-42(40(30-37)35-23-21-34(22-24-35)32-13-5-2-6-14-32)47-45-44(36-17-9-4-10-18-36)48(45)43-20-12-11-19-41(43)46/h2-26,28-31,44-45,47H,27,46H2,1H3/t31-,44?,45-,48?/m0/s1 |
| InChIKey | NGCIGZUAXNFQBZ-JOSIUALLSA-N |
| XLogP | 11.11 |
| TPSA | 41.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.83 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|