C35H31N3 — CID 118449545
(2S)-1-(2-aminophenyl)-N-(9,9-dimethyl-2-phenylfluoren-3-yl)-3-phenylaziridin-2-amine (PubChem CID 118449545) has the molecular formula C35H31N3 and a molecular weight of 493.65 g/mol. Its IUPAC name is (2S)-1-(2-aminophenyl)-N-(9,9-dimethyl-2-phenylfluoren-3-yl)-3-phenylaziridin-2-amine.
| Compound Name | (2S)-1-(2-aminophenyl)-N-(9,9-dimethyl-2-phenylfluoren-3-yl)-3-phenylaziridin-2-amine |
|---|---|
| PubChem CID | 118449545 |
| Molecular Formula | C35H31N3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (2S)-1-(2-aminophenyl)-N-(9,9-dimethyl-2-phenylfluoren-3-yl)-3-phenylaziridin-2-amine |
| SMILES | CC1(C)c2ccccc2-c2cc(N[C@@H]3C(c4ccccc4)N3c3ccccc3N)c(-c3ccccc3)cc21 |
| InChI | InChI=1S/C35H31N3/c1-35(2)28-18-10-9-17-25(28)27-22-31(26(21-29(27)35)23-13-5-3-6-14-23)37-34-33(24-15-7-4-8-16-24)38(34)32-20-12-11-19-30(32)36/h3-22,33-34,37H,36H2,1-2H3/t33?,34-,38?/m0/s1 |
| InChIKey | LXMPYSQLRKKPLW-GYSWBSHDSA-N |
| XLogP | 8.24 |
| TPSA | 41.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|