C48H35N3 — CID 139400666
2-[3-[3-(9,9-dimethyl-3-phenylfluoren-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 139400666) has the molecular formula C48H35N3 and a molecular weight of 653.83 g/mol. Its IUPAC name is 2-[3-[3-(9,9-dimethyl-3-phenylfluoren-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-(9,9-dimethyl-3-phenylfluoren-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 139400666 |
| Molecular Formula | C48H35N3 |
| Molecular Weight | 653.83 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | 2-[3-[3-(9,9-dimethyl-3-phenylfluoren-2-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc(-c3ccccc3)c(-c3cccc(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)cc21 |
| InChI | InChI=1S/C48H35N3/c1-48(2)43-27-13-12-26-39(43)42-30-40(32-16-6-3-7-17-32)41(31-44(42)48)37-24-14-22-35(28-37)36-23-15-25-38(29-36)47-50-45(33-18-8-4-9-19-33)49-46(51-47)34-20-10-5-11-21-34/h3-31H,1-2H3 |
| InChIKey | GNIQVEINJVPHMN-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.83 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |