C51H39N3 — CID 166901559
2-phenyl-4-(4-phenylphenyl)-6-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-4-yl)phenyl]-1,3,5-triazine (PubChem CID 166901559) has the molecular formula C51H39N3 and a molecular weight of 693.89 g/mol. Its IUPAC name is 2-phenyl-4-(4-phenylphenyl)-6-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-4-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4-(4-phenylphenyl)-6-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-4-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166901559 |
| Molecular Formula | C51H39N3 |
| Molecular Weight | 693.89 g/mol |
| Exact Mass | 693.31 |
| IUPAC Name | 2-phenyl-4-(4-phenylphenyl)-6-[4-(6,6,12,12-tetramethylindeno[1,2-b]fluoren-4-yl)phenyl]-1,3,5-triazine |
| SMILES | CC1(C)c2ccccc2-c2cc3c(cc21)-c1c(-c2ccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5)n4)cc2)cccc1C3(C)C |
| InChI | InChI=1S/C51H39N3/c1-50(2)42-20-12-11-18-39(42)40-30-45-41(31-44(40)50)46-38(19-13-21-43(46)51(45,3)4)34-24-28-37(29-25-34)49-53-47(35-16-9-6-10-17-35)52-48(54-49)36-26-22-33(23-27-36)32-14-7-5-8-15-32/h5-31H,1-4H3 |
| InChIKey | WGZCOFZJPGSAMZ-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.89 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |