C40H37N3 — CID 118930721
2-[3-(1,4,4a,8a-tetrahydroquinolin-3-yl)-5-methylcyclohexa-1,3-dien-1-yl]-4-(4-anilino-3-phenylphenyl)aniline (PubChem CID 118930721) has the molecular formula C40H37N3 and a molecular weight of 559.76 g/mol. Its IUPAC name is 2-[3-(1,4,4a,8a-tetrahydroquinolin-3-yl)-5-methylcyclohexa-1,3-dien-1-yl]-4-(4-anilino-3-phenylphenyl)aniline.
| Compound Name | 2-[3-(1,4,4a,8a-tetrahydroquinolin-3-yl)-5-methylcyclohexa-1,3-dien-1-yl]-4-(4-anilino-3-phenylphenyl)aniline |
|---|---|
| PubChem CID | 118930721 |
| Molecular Formula | C40H37N3 |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.30 |
| IUPAC Name | 2-[3-(1,4,4a,8a-tetrahydroquinolin-3-yl)-5-methylcyclohexa-1,3-dien-1-yl]-4-(4-anilino-3-phenylphenyl)aniline |
| SMILES | CC1C=C(C2=CNC3C=CC=CC3C2)C=C(c2cc(-c3ccc(Nc4ccccc4)c(-c4ccccc4)c3)ccc2N)C1 |
| InChI | InChI=1S/C40H37N3/c1-27-20-32(34-22-31-12-8-9-15-39(31)42-26-34)23-33(21-27)36-24-29(16-18-38(36)41)30-17-19-40(43-35-13-6-3-7-14-35)37(25-30)28-10-4-2-5-11-28/h2-20,23-27,31,39,42-43H,21-22,41H2,1H3 |
| InChIKey | GMFZGXQLOWNLLL-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|