About 2-methyl-1,2-dihydrotriphenylene
2-methyl-1,2-dihydrotriphenylene (PubChem CID 145204096) has the molecular formula C19H16
and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-methyl-1,2-dihydrotriphenylene.
Molecular Properties
| Compound Name | 2-methyl-1,2-dihydrotriphenylene |
| PubChem CID | 145204096 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-methyl-1,2-dihydrotriphenylene |
| SMILES | CC1C=Cc2c(c3ccccc3c3ccccc23)C1 |
| InChI | InChI=1S/C19H16/c1-13-10-11-18-16-8-3-2-6-14(16)15-7-4-5-9-17(15)19(18)12-13/h2-11,13H,12H2,1H3 |
| InChIKey | ZPMFGPRZBKZRIW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,2-dihydrotriphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,2-dihydrotriphenylene?
The IUPAC name of 2-methyl-1,2-dihydrotriphenylene (CID 145204096) is 2-methyl-1,2-dihydrotriphenylene.
What is the SMILES notation for 2-methyl-1,2-dihydrotriphenylene?
The canonical SMILES for 2-methyl-1,2-dihydrotriphenylene is CC1C=Cc2c(c3ccccc3c3ccccc23)C1.
What is the InChIKey of 2-methyl-1,2-dihydrotriphenylene?
The InChIKey is ZPMFGPRZBKZRIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16/c1-13-10-11-18-16-8-3-2-6-14(16)15-7-4-5-9-17(15)19(18)12-13/h2-11,13H,12H2,1H3.
What are the key properties of 2-methyl-1,2-dihydrotriphenylene?
2-methyl-1,2-dihydrotriphenylene has a molecular weight of 244.34 g/mol, XLogP of 5.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,2-dihydrotriphenylene is sourced from PubChem (CID 145204096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).