C29H29N3 — CID 146359887
N-[(Z)-[3-amino-2-methyl-3-(11-methyl-11,12-dihydrotriphenylen-2-yl)propylidene]amino]aniline (PubChem CID 146359887) has the molecular formula C29H29N3 and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[(Z)-[3-amino-2-methyl-3-(11-methyl-11,12-dihydrotriphenylen-2-yl)propylidene]amino]aniline.
| Compound Name | N-[(Z)-[3-amino-2-methyl-3-(11-methyl-11,12-dihydrotriphenylen-2-yl)propylidene]amino]aniline |
|---|---|
| PubChem CID | 146359887 |
| Molecular Formula | C29H29N3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | N-[(Z)-[3-amino-2-methyl-3-(11-methyl-11,12-dihydrotriphenylen-2-yl)propylidene]amino]aniline |
| SMILES | CC1C=Cc2c(c3cc(C(N)C(C)/C=N\Nc4ccccc4)ccc3c3ccccc23)C1 |
| InChI | InChI=1S/C29H29N3/c1-19-12-14-25-23-10-6-7-11-24(23)26-15-13-21(17-28(26)27(25)16-19)29(30)20(2)18-31-32-22-8-4-3-5-9-22/h3-15,17-20,29,32H,16,30H2,1-2H3/b31-18- |
| InChIKey | IJGPYEQYPKMIOO-MNBJERMJSA-N |
| XLogP | 6.93 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|