C27H29BO2 — CID 147149825
4,4,5,5-tetramethyl-2-(3-methyl-10-phenyl-3,4-dihydroanthracen-9-yl)-1,3,2-dioxaborolane (PubChem CID 147149825) has the molecular formula C27H29BO2 and a molecular weight of 396.34 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(3-methyl-10-phenyl-3,4-dihydroanthracen-9-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(3-methyl-10-phenyl-3,4-dihydroanthracen-9-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 147149825 |
| Molecular Formula | C27H29BO2 |
| Molecular Weight | 396.34 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(3-methyl-10-phenyl-3,4-dihydroanthracen-9-yl)-1,3,2-dioxaborolane |
| SMILES | CC1C=Cc2c(c(-c3ccccc3)c3ccccc3c2B2OC(C)(C)C(C)(C)O2)C1 |
| InChI | InChI=1S/C27H29BO2/c1-18-15-16-22-23(17-18)24(19-11-7-6-8-12-19)20-13-9-10-14-21(20)25(22)28-29-26(2,3)27(4,5)30-28/h6-16,18H,17H2,1-5H3 |
| InChIKey | BTTVBGAVFSFIGD-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.34 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|