C26H25BO3 — CID 177094722
2-(3,5-diphenyl-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 177094722) has the molecular formula C26H25BO3 and a molecular weight of 396.30 g/mol. Its IUPAC name is 2-(3,5-diphenyl-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3,5-diphenyl-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177094722 |
| Molecular Formula | C26H25BO3 |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-(3,5-diphenyl-1-benzofuran-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2oc3ccc(-c4ccccc4)cc3c2-c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C26H25BO3/c1-25(2)26(3,4)30-27(29-25)24-23(19-13-9-6-10-14-19)21-17-20(15-16-22(21)28-24)18-11-7-5-8-12-18/h5-17H,1-4H3 |
| InChIKey | VKDFETOXMCVXKE-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|