C54H44BNO2 — CID 156710666
3,6-bis(4-phenylphenyl)-9-[4-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole (PubChem CID 156710666) has the molecular formula C54H44BNO2 and a molecular weight of 749.76 g/mol. Its IUPAC name is 3,6-bis(4-phenylphenyl)-9-[4-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole.
| Compound Name | 3,6-bis(4-phenylphenyl)-9-[4-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 156710666 |
| Molecular Formula | C54H44BNO2 |
| Molecular Weight | 749.76 g/mol |
| Exact Mass | 749.35 |
| IUPAC Name | 3,6-bis(4-phenylphenyl)-9-[4-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]carbazole |
| SMILES | CC1(C)OB(c2cc(-c3ccccc3)ccc2-n2c3ccc(-c4ccc(-c5ccccc5)cc4)cc3c3cc(-c4ccc(-c5ccccc5)cc4)ccc32)OC1(C)C |
| InChI | InChI=1S/C54H44BNO2/c1-53(2)54(3,4)58-55(57-53)49-36-46(39-18-12-7-13-19-39)30-33-52(49)56-50-31-28-44(42-24-20-40(21-25-42)37-14-8-5-9-15-37)34-47(50)48-35-45(29-32-51(48)56)43-26-22-41(23-27-43)38-16-10-6-11-17-38/h5-36H,1-4H3 |
| InChIKey | RBYHDAJHQKBCEK-UHFFFAOYSA-N |
| XLogP | 13.42 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.76 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|