C31H30BNO3 — CID 147834563
3-methyl-12-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-[1]benzofuro[2,3-a]carbazole (PubChem CID 147834563) has the molecular formula C31H30BNO3 and a molecular weight of 475.40 g/mol. Its IUPAC name is 3-methyl-12-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-[1]benzofuro[2,3-a]carbazole.
| Compound Name | 3-methyl-12-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-[1]benzofuro[2,3-a]carbazole |
|---|---|
| PubChem CID | 147834563 |
| Molecular Formula | C31H30BNO3 |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | 3-methyl-12-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-[1]benzofuro[2,3-a]carbazole |
| SMILES | CC1C=Cc2c(c3c(B4OC(C)(C)C(C)(C)O4)cc4c5ccccc5oc4c3n2-c2ccccc2)C1 |
| InChI | InChI=1S/C31H30BNO3/c1-19-15-16-25-23(17-19)27-24(32-35-30(2,3)31(4,5)36-32)18-22-21-13-9-10-14-26(21)34-29(22)28(27)33(25)20-11-7-6-8-12-20/h6-16,18-19H,17H2,1-5H3 |
| InChIKey | HRTGPGLNFPOGOC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 36.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|