C28H27BN2O3 — CID 145306479
N-methyl-6-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[3,2-c]isoquinolin-5-imine (PubChem CID 145306479) has the molecular formula C28H27BN2O3 and a molecular weight of 450.35 g/mol. Its IUPAC name is N-methyl-6-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[3,2-c]isoquinolin-5-imine.
| Compound Name | N-methyl-6-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[3,2-c]isoquinolin-5-imine |
|---|---|
| PubChem CID | 145306479 |
| Molecular Formula | C28H27BN2O3 |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-methyl-6-phenyl-8-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-[1]benzofuro[3,2-c]isoquinolin-5-imine |
| SMILES | C/N=c1\c2ccccc2c2oc3ccc(B4OC(C)(C)C(C)(C)O4)cc3c2n1-c1ccccc1 |
| InChI | InChI=1S/C28H27BN2O3/c1-27(2)28(3,4)34-29(33-27)18-15-16-23-22(17-18)24-25(32-23)20-13-9-10-14-21(20)26(30-5)31(24)19-11-7-6-8-12-19/h6-17H,1-5H3/b30-26+ |
| InChIKey | CZEHHRKNLZPBTC-URGPHPNLSA-N |
| XLogP | 5.36 |
| TPSA | 48.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|