C36H33BO2 — CID 90295397
2-[4-[4-(9,10-dihydrotriphenylen-2-yl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 90295397) has the molecular formula C36H33BO2 and a molecular weight of 508.47 g/mol. Its IUPAC name is 2-[4-[4-(9,10-dihydrotriphenylen-2-yl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[4-(9,10-dihydrotriphenylen-2-yl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 90295397 |
| Molecular Formula | C36H33BO2 |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | 2-[4-[4-(9,10-dihydrotriphenylen-2-yl)phenyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4ccc5c(c4)c4c(c6ccccc65)CCC=C4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C36H33BO2/c1-35(2)36(3,4)39-37(38-35)28-20-17-25(18-21-28)24-13-15-26(16-14-24)27-19-22-33-31-11-6-5-9-29(31)30-10-7-8-12-32(30)34(33)23-27/h5-6,8-9,11-23H,7,10H2,1-4H3 |
| InChIKey | YKEDIZVYFIOIEV-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|