C18H13Br — CID 144751099
6-bromo-1,2-dihydrotriphenylene (PubChem CID 144751099) has the molecular formula C18H13Br and a molecular weight of 309.21 g/mol. Its IUPAC name is 6-bromo-1,2-dihydrotriphenylene.
| Compound Name | 6-bromo-1,2-dihydrotriphenylene |
|---|---|
| PubChem CID | 144751099 |
| Molecular Formula | C18H13Br |
| Molecular Weight | 309.21 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 6-bromo-1,2-dihydrotriphenylene |
| SMILES | Brc1ccc2c(c1)c1c(c3ccccc32)CCC=C1 |
| InChI | InChI=1S/C18H13Br/c19-12-9-10-17-15-7-2-1-5-13(15)14-6-3-4-8-16(14)18(17)11-12/h1-2,4-5,7-11H,3,6H2 |
| InChIKey | NCCXUMPBDPFIOT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.21 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|