C20H24 — CID 155644326
9,10-di(propan-2-yl)-3,4-dihydrophenanthrene (PubChem CID 155644326) has the molecular formula C20H24 and a molecular weight of 264.41 g/mol. Its IUPAC name is 9,10-di(propan-2-yl)-3,4-dihydrophenanthrene.
| Compound Name | 9,10-di(propan-2-yl)-3,4-dihydrophenanthrene |
|---|---|
| PubChem CID | 155644326 |
| Molecular Formula | C20H24 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 9,10-di(propan-2-yl)-3,4-dihydrophenanthrene |
| SMILES | CC(C)c1c2c(c3ccccc3c1C(C)C)CCC=C2 |
| InChI | InChI=1S/C20H24/c1-13(2)19-17-11-7-5-9-15(17)16-10-6-8-12-18(16)20(19)14(3)4/h5,7-9,11-14H,6,10H2,1-4H3 |
| InChIKey | AQFWGIFLQNXQDL-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |