C19H15NO — CID 153394465
5-phenyl-9,10-dihydrophenanthridin-6-one (PubChem CID 153394465) has the molecular formula C19H15NO and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-phenyl-9,10-dihydrophenanthridin-6-one.
| Compound Name | 5-phenyl-9,10-dihydrophenanthridin-6-one |
|---|---|
| PubChem CID | 153394465 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 5-phenyl-9,10-dihydrophenanthridin-6-one |
| SMILES | O=c1c2c(c3ccccc3n1-c1ccccc1)CCC=C2 |
| InChI | InChI=1S/C19H15NO/c21-19-17-12-5-4-10-15(17)16-11-6-7-13-18(16)20(19)14-8-2-1-3-9-14/h1-3,5-9,11-13H,4,10H2 |
| InChIKey | UQSPROWMMGBLMT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |