C19H17N — CID 143532296
5-phenyl-7,8-dihydro-6H-cyclohepta[b]indole (PubChem CID 143532296) has the molecular formula C19H17N and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-phenyl-7,8-dihydro-6H-cyclohepta[b]indole.
| Compound Name | 5-phenyl-7,8-dihydro-6H-cyclohepta[b]indole |
|---|---|
| PubChem CID | 143532296 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 5-phenyl-7,8-dihydro-6H-cyclohepta[b]indole |
| SMILES | C1=Cc2c(n(-c3ccccc3)c3ccccc23)CCC1 |
| InChI | InChI=1S/C19H17N/c1-3-9-15(10-4-1)20-18-13-6-2-5-11-16(18)17-12-7-8-14-19(17)20/h1,3-5,7-12,14H,2,6,13H2 |
| InChIKey | TXAIRCYHRNWVFF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |