C28H21NS — CID 71011281
9-[4-(5-phenylthiophen-2-yl)phenyl]-1,2-dihydrocarbazole (PubChem CID 71011281) has the molecular formula C28H21NS and a molecular weight of 403.55 g/mol. Its IUPAC name is 9-[4-(5-phenylthiophen-2-yl)phenyl]-1,2-dihydrocarbazole.
| Compound Name | 9-[4-(5-phenylthiophen-2-yl)phenyl]-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 71011281 |
| Molecular Formula | C28H21NS |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 9-[4-(5-phenylthiophen-2-yl)phenyl]-1,2-dihydrocarbazole |
| SMILES | C1=Cc2c(n(-c3ccc(-c4ccc(-c5ccccc5)s4)cc3)c3ccccc23)CC1 |
| InChI | InChI=1S/C28H21NS/c1-2-8-20(9-3-1)27-18-19-28(30-27)21-14-16-22(17-15-21)29-25-12-6-4-10-23(25)24-11-5-7-13-26(24)29/h1-6,8-12,14-19H,7,13H2 |
| InChIKey | YPYAFKLTVJPGOY-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |