[4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid

C18H16BNO2 — CID 154692123

IUPAC[4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid
SMILESOB(O)c1ccc(-n2c3c(c4ccccc42)C=CCC3)cc1
InChIInChI=1S/C18H16BNO2/c21-19(22)13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1-3,5-7,9-12,21-22H,4,8H2
InChIKeyUGVIQQCSKOJQLV-UHFFFAOYSA-N
MW289.14 g/mol
LogP2.27
Rot. Bonds2

About [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid

[4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid (PubChem CID 154692123) has the molecular formula C18H16BNO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid.

Molecular Properties

Compound Name[4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid
PubChem CID154692123
Molecular FormulaC18H16BNO2
Molecular Weight289.14 g/mol
Exact Mass289.13
IUPAC Name[4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid
SMILESOB(O)c1ccc(-n2c3c(c4ccccc42)C=CCC3)cc1
InChIInChI=1S/C18H16BNO2/c21-19(22)13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1-3,5-7,9-12,21-22H,4,8H2
InChIKeyUGVIQQCSKOJQLV-UHFFFAOYSA-N
XLogP2.27
TPSA45.39 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.14
LogP ≤ 52.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid?
The IUPAC name of [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid (CID 154692123) is [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid.
What is the SMILES notation for [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid?
The canonical SMILES for [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid is OB(O)c1ccc(-n2c3c(c4ccccc42)C=CCC3)cc1.
What is the InChIKey of [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid?
The InChIKey is UGVIQQCSKOJQLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16BNO2/c21-19(22)13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1-3,5-7,9-12,21-22H,4,8H2.
What are the key properties of [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid?
[4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid has a molecular weight of 289.14 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid is sourced from PubChem (CID 154692123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).