C18H16BNO2 — CID 154692123
[4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid (PubChem CID 154692123) has the molecular formula C18H16BNO2 and a molecular weight of 289.14 g/mol. Its IUPAC name is [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid.
| Compound Name | [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 154692123 |
| Molecular Formula | C18H16BNO2 |
| Molecular Weight | 289.14 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [4-(1,2-dihydrocarbazol-9-yl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-n2c3c(c4ccccc42)C=CCC3)cc1 |
| InChI | InChI=1S/C18H16BNO2/c21-19(22)13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1-3,5-7,9-12,21-22H,4,8H2 |
| InChIKey | UGVIQQCSKOJQLV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|