C37H31N — CID 144976701
9-[4-[(3E,5E)-4,6-diphenylhepta-1,3,5-trien-2-yl]phenyl]-1,2-dihydrocarbazole (PubChem CID 144976701) has the molecular formula C37H31N and a molecular weight of 489.66 g/mol. Its IUPAC name is 9-[4-[(3E,5E)-4,6-diphenylhepta-1,3,5-trien-2-yl]phenyl]-1,2-dihydrocarbazole.
| Compound Name | 9-[4-[(3E,5E)-4,6-diphenylhepta-1,3,5-trien-2-yl]phenyl]-1,2-dihydrocarbazole |
|---|---|
| PubChem CID | 144976701 |
| Molecular Formula | C37H31N |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 9-[4-[(3E,5E)-4,6-diphenylhepta-1,3,5-trien-2-yl]phenyl]-1,2-dihydrocarbazole |
| SMILES | C=C(/C=C(\C=C(/C)c1ccccc1)c1ccccc1)c1ccc(-n2c3c(c4ccccc42)C=CCC3)cc1 |
| InChI | InChI=1S/C37H31N/c1-27(29-13-5-3-6-14-29)25-32(31-15-7-4-8-16-31)26-28(2)30-21-23-33(24-22-30)38-36-19-11-9-17-34(36)35-18-10-12-20-37(35)38/h3-11,13-19,21-26H,2,12,20H2,1H3/b27-25+,32-26+ |
| InChIKey | PJPQRWWTHZEKOC-ZXTRRPQGSA-N |
| XLogP | 9.79 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|