C31H26N2O — CID 70991147
[3,5-bis(1,2-dihydrocarbazol-9-yl)phenyl]methanol (PubChem CID 70991147) has the molecular formula C31H26N2O and a molecular weight of 442.56 g/mol. Its IUPAC name is [3,5-bis(1,2-dihydrocarbazol-9-yl)phenyl]methanol.
| Compound Name | [3,5-bis(1,2-dihydrocarbazol-9-yl)phenyl]methanol |
|---|---|
| PubChem CID | 70991147 |
| Molecular Formula | C31H26N2O |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [3,5-bis(1,2-dihydrocarbazol-9-yl)phenyl]methanol |
| SMILES | OCc1cc(-n2c3c(c4ccccc42)C=CCC3)cc(-n2c3c(c4ccccc42)C=CCC3)c1 |
| InChI | InChI=1S/C31H26N2O/c34-20-21-17-22(32-28-13-5-1-9-24(28)25-10-2-6-14-29(25)32)19-23(18-21)33-30-15-7-3-11-26(30)27-12-4-8-16-31(27)33/h1-5,7,9-13,15,17-19,34H,6,8,14,16,20H2 |
| InChIKey | KTDNBUPBSOKYIZ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 30.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |