C14H10Cl2 — CID 154158053
9,10-dichloro-1,2-dihydroanthracene (PubChem CID 154158053) has the molecular formula C14H10Cl2 and a molecular weight of 249.14 g/mol. Its IUPAC name is 9,10-dichloro-1,2-dihydroanthracene.
| Compound Name | 9,10-dichloro-1,2-dihydroanthracene |
|---|---|
| PubChem CID | 154158053 |
| Molecular Formula | C14H10Cl2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 9,10-dichloro-1,2-dihydroanthracene |
| SMILES | Clc1c2c(c(Cl)c3ccccc13)CCC=C2 |
| InChI | InChI=1S/C14H10Cl2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h1-3,5-7H,4,8H2 |
| InChIKey | YUMOBFZBOVOLLS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |