C15H11NO3 — CID 154194633
2-(2-hydroxyphenyl)-4-imino-3aH-indene-1,3-dione (PubChem CID 154194633) has the molecular formula C15H11NO3 and a molecular weight of 253.26 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-4-imino-3aH-indene-1,3-dione.
| Compound Name | 2-(2-hydroxyphenyl)-4-imino-3aH-indene-1,3-dione |
|---|---|
| PubChem CID | 154194633 |
| Molecular Formula | C15H11NO3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-(2-hydroxyphenyl)-4-imino-3aH-indene-1,3-dione |
| SMILES | [H]/N=C1\C=CC=C2C(=O)C(c3ccccc3O)C(=O)C21 |
| InChI | InChI=1S/C15H11NO3/c16-10-6-3-5-9-12(10)15(19)13(14(9)18)8-4-1-2-7-11(8)17/h1-7,12-13,16-17H/b16-10+ |
| InChIKey | PJVIBYLBHBNINW-MHWRWJLKSA-N |
| XLogP | 1.76 |
| TPSA | 78.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|