C14H24S — CID 142071881
2,3-bis(ethenyl)-5-ethylthiophene;ethane (PubChem CID 142071881) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-5-ethylthiophene;ethane.
| Compound Name | 2,3-bis(ethenyl)-5-ethylthiophene;ethane |
|---|---|
| PubChem CID | 142071881 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2,3-bis(ethenyl)-5-ethylthiophene;ethane |
| SMILES | C=Cc1cc(CC)sc1C=C.CC.CC |
| InChI | InChI=1S/C10H12S.2C2H6/c1-4-8-7-9(5-2)11-10(8)6-3;2*1-2/h4,6-7H,1,3,5H2,2H3;2*1-2H3 |
| InChIKey | JTBYYIUWGUNVAB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |