C10H12OS — CID 15474052
2-ethyl-4,6-dimethylthieno[2,3-c]furan (PubChem CID 15474052) has the molecular formula C10H12OS and a molecular weight of 180.27 g/mol. Its IUPAC name is 2-ethyl-4,6-dimethylthieno[2,3-c]furan.
| Compound Name | 2-ethyl-4,6-dimethylthieno[2,3-c]furan |
|---|---|
| PubChem CID | 15474052 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 2-ethyl-4,6-dimethylthieno[2,3-c]furan |
| SMILES | CCc1cc2c(C)oc(C)c2s1 |
| InChI | InChI=1S/C10H12OS/c1-4-8-5-9-6(2)11-7(3)10(9)12-8/h5H,4H2,1-3H3 |
| InChIKey | IRLLANKRYXQIHP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |