C12H13BrS — CID 131029500
4-bromo-2,6-diethyl-1-benzothiophene (PubChem CID 131029500) has the molecular formula C12H13BrS and a molecular weight of 269.21 g/mol. Its IUPAC name is 4-bromo-2,6-diethyl-1-benzothiophene.
| Compound Name | 4-bromo-2,6-diethyl-1-benzothiophene |
|---|---|
| PubChem CID | 131029500 |
| Molecular Formula | C12H13BrS |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 4-bromo-2,6-diethyl-1-benzothiophene |
| SMILES | CCc1cc(Br)c2cc(CC)sc2c1 |
| InChI | InChI=1S/C12H13BrS/c1-3-8-5-11(13)10-7-9(4-2)14-12(10)6-8/h5-7H,3-4H2,1-2H3 |
| InChIKey | ZUNJAHQWRKJWOK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |