C10H13Br2O3PS — CID 21420848
(2,6-dibromo-4-ethylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane (PubChem CID 21420848) has the molecular formula C10H13Br2O3PS and a molecular weight of 404.06 g/mol. Its IUPAC name is (2,6-dibromo-4-ethylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | (2,6-dibromo-4-ethylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 21420848 |
| Molecular Formula | C10H13Br2O3PS |
| Molecular Weight | 404.06 g/mol |
| Exact Mass | 401.87 |
| IUPAC Name | (2,6-dibromo-4-ethylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCc1cc(Br)c(OP(=S)(OC)OC)c(Br)c1 |
| InChI | InChI=1S/C10H13Br2O3PS/c1-4-7-5-8(11)10(9(12)6-7)15-16(17,13-2)14-3/h5-6H,4H2,1-3H3 |
| InChIKey | IWVAPVFTNPYWNU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.06 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|