C15H16S2 — CID 144783026
7-ethyl-2-propan-2-ylthieno[3,2-e][1]benzothiole (PubChem CID 144783026) has the molecular formula C15H16S2 and a molecular weight of 260.43 g/mol. Its IUPAC name is 7-ethyl-2-propan-2-ylthieno[3,2-e][1]benzothiole.
| Compound Name | 7-ethyl-2-propan-2-ylthieno[3,2-e][1]benzothiole |
|---|---|
| PubChem CID | 144783026 |
| Molecular Formula | C15H16S2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 7-ethyl-2-propan-2-ylthieno[3,2-e][1]benzothiole |
| SMILES | CCc1cc2c(ccc3sc(C(C)C)cc32)s1 |
| InChI | InChI=1S/C15H16S2/c1-4-10-7-11-12-8-15(9(2)3)17-14(12)6-5-13(11)16-10/h5-9H,4H2,1-3H3 |
| InChIKey | JQAHMLZOXZWJRS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |