C8H7NO3S — CID 170859770
6-ethyl-1H-thieno[2,3-d][1,3]oxazine-2,4-dione (PubChem CID 170859770) has the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. Its IUPAC name is 6-ethyl-1H-thieno[2,3-d][1,3]oxazine-2,4-dione.
| Compound Name | 6-ethyl-1H-thieno[2,3-d][1,3]oxazine-2,4-dione |
|---|---|
| PubChem CID | 170859770 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 6-ethyl-1H-thieno[2,3-d][1,3]oxazine-2,4-dione |
| SMILES | CCc1cc2c(=O)oc(=O)[nH]c2s1 |
| InChI | InChI=1S/C8H7NO3S/c1-2-4-3-5-6(13-4)9-8(11)12-7(5)10/h3H,2H2,1H3,(H,9,11) |
| InChIKey | XNXNEHQSUYAEIN-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |