C16H13NO2S — CID 92993671
6-ethyl-2-[(Z)-2-phenylethenyl]thieno[2,3-d][1,3]oxazin-4-one (PubChem CID 92993671) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is 6-ethyl-2-[(Z)-2-phenylethenyl]thieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 6-ethyl-2-[(Z)-2-phenylethenyl]thieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 92993671 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 6-ethyl-2-[(Z)-2-phenylethenyl]thieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCc1cc2c(=O)oc(/C=C\c3ccccc3)nc2s1 |
| InChI | InChI=1S/C16H13NO2S/c1-2-12-10-13-15(20-12)17-14(19-16(13)18)9-8-11-6-4-3-5-7-11/h3-10H,2H2,1H3/b9-8- |
| InChIKey | KBORNGWAAUERAS-HJWRWDBZSA-N |
| XLogP | 3.98 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |