C33H20N4O8 — CID 3106708
2-[2-(4-nitrophenyl)ethenyl]-6-[[2-[2-(4-nitrophenyl)ethenyl]-4-oxo-3,1-benzoxazin-6-yl]methyl]-3,1-benzoxazin-4-one (PubChem CID 3106708) has the molecular formula C33H20N4O8 and a molecular weight of 600.54 g/mol. Its IUPAC name is 2-[2-(4-nitrophenyl)ethenyl]-6-[[2-[2-(4-nitrophenyl)ethenyl]-4-oxo-3,1-benzoxazin-6-yl]methyl]-3,1-benzoxazin-4-one.
| Compound Name | 2-[2-(4-nitrophenyl)ethenyl]-6-[[2-[2-(4-nitrophenyl)ethenyl]-4-oxo-3,1-benzoxazin-6-yl]methyl]-3,1-benzoxazin-4-one |
|---|---|
| PubChem CID | 3106708 |
| Molecular Formula | C33H20N4O8 |
| Molecular Weight | 600.54 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | 2-[2-(4-nitrophenyl)ethenyl]-6-[[2-[2-(4-nitrophenyl)ethenyl]-4-oxo-3,1-benzoxazin-6-yl]methyl]-3,1-benzoxazin-4-one |
| SMILES | O=c1oc(C=Cc2ccc([N+](=O)[O-])cc2)nc2ccc(Cc3ccc4nc(C=Cc5ccc([N+](=O)[O-])cc5)oc(=O)c4c3)cc12 |
| InChI | InChI=1S/C33H20N4O8/c38-32-26-18-22(5-13-28(26)34-30(44-32)15-7-20-1-9-24(10-2-20)36(40)41)17-23-6-14-29-27(19-23)33(39)45-31(35-29)16-8-21-3-11-25(12-4-21)37(42)43/h1-16,18-19H,17H2 |
| InChIKey | XCRVUJANIPDKIH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 172.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|