C19H13NO5 — CID 626222
[2-[2-(4-formylphenyl)ethenyl]-4-oxo-3,1-benzoxazin-6-yl] acetate (PubChem CID 626222) has the molecular formula C19H13NO5 and a molecular weight of 335.32 g/mol. Its IUPAC name is [2-[2-(4-formylphenyl)ethenyl]-4-oxo-3,1-benzoxazin-6-yl] acetate.
| Compound Name | [2-[2-(4-formylphenyl)ethenyl]-4-oxo-3,1-benzoxazin-6-yl] acetate |
|---|---|
| PubChem CID | 626222 |
| Molecular Formula | C19H13NO5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [2-[2-(4-formylphenyl)ethenyl]-4-oxo-3,1-benzoxazin-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(C=Cc3ccc(C=O)cc3)oc(=O)c2c1 |
| InChI | InChI=1S/C19H13NO5/c1-12(22)24-15-7-8-17-16(10-15)19(23)25-18(20-17)9-6-13-2-4-14(11-21)5-3-13/h2-11H,1H3 |
| InChIKey | DTIHFGGLAKMMET-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|